|
Chemistry 251/253 |
|
Homework 10 |
2. Arrange the following compounds in order of increasing
reactivity in electrophilic aromatic substitution
reactions.
C<A<B
3. Enter the number of the atom in
that would be protonated first in an acidic solution.
2 The lone pair of electrons on the nitrogen is
perpendicular to the pi system of the heteroaromatic ring.
4. Enter the number of the atom in
where electrophilic aromatic substitution would occur preferentially.
1 While there is in reality only one pi system
in this molecule, you may consider the two rings independently. The
5-membered ring is electron rich, while the 6-membered ring is
electron poor. Therefore, an electrophile will react preferentially
with the 5-membered ring.
5. How many of the following structures are consistent with the MO
diagram ?
2
The 2nd and 3rd.
6. Draw the structure of the major product of the following
reaction.Cc1c(Cl)oc2c(C)cccc12
7. Arrange the following compounds in order of increasing
basicity:2<3<1
8. Draw the resonance structure that makes the most important
contribution to the intermediate that is formed in the following
reaction:ClC1C=CC=[O+]1
9. Bromination of thiophene-3-carboxylic acid,
, produces 5-bromothiophene-3-carboxylic acid and none of the 2-bromo
isomer. Draw the resonance structure that indicates most clearly why
attack of the Br+ at C-2 generates a less stable
intermediate than attack at C-5.
OC(=O)[C+]1C=CSC1Br
If the Br+ bonds to C-2, it generates a carbocationic
intermediate in which the positive charge develops on C-3, adjacent
to the partial positive charge on the carboxyl carbon. This is a
destabilizing interaction. A comparable interaction is not possible
when the Br+ bonds to C-5.
10. Use the principles of resonance theory to predict the number
of the atom in pyrrole, ,
that would be protonated preferentially. 2
11. Bromination of pyridine, ,
under forcing conditions produces 3-bromopyridine in 86% yield. How
many of the structures shown below represent legitimate resonance
contributors for the intermediate that is involved in this reaction?
2 In the first structure C-2 is tetravalent,
while the last structure is not a valid resonance structure because
the lone pair of electrons on the nitrogen is orthogonal to the pi
system.
12. Pyridine is classified as an electron deficient heteroaromatic
compound. As such it is susceptible to reaction with nucleophiles.
For example, treatment of pyridine with sodium amide produces
2-aminopyridine in 70% yield:.
What is the equilibrium constant for this reaction?
10e3
13. Furans are relatively unstable when treated with aqueous acid.
For example, 2,5-dimethylfuran reacts with an aqueous mixture of
acetic and sulfuric acids to generate the compound that gives the
attached 1H-NMR
spectrum in 90% yield. Draw the structure of this
compound.CC(=O)CCC(=O)C
14. How many isomeric tertiary amines are there with the molecular
formula C5H13N? 3
15. Many physiologically active compounds are derivatives of
2-phenylethanamine,
C6H5CH2CH2NH2.
During a recent drug bust, police seized a large quantity of a
compound that gave the attached 1H-NMR
spectrum. Draw the structure of the compound that the drug dealer was
selling.COc1cc(CCN)cc(OC)c1OC
16. Select the reaction conditions you would use to affect the
following transformation:.
|
A. Mix the reactants in a 1/1 ratio. |
B. Use a large excess of methyl bromide. |
C. Use a large excess of butanamine. |
17. Consider the attached 1H-NMR spectrum of a monosubstituted benzene derivative. Then select the statement that best describes the outcome of nitration of this material.
|
A. The compound will react faster than benzene to produce a mixture of ortho and para isomers. |
B. The compound will react faster than benzene to form predominantly the para isomer. |
C. The compound will react slower than benzene to produce a mixture of ortho and para isomers. |
D. The compound will react slower than benzene to produce predominantly the meta isomer. |
The structure of the compound is .
18. Draw the starting material A that was used in the following
synthesis:O=C1CCC=C1
This sequence begins with a 1,4-addition of HCN
to the a,b-unsaturated
ketone. Reduction of product B followed by acidification of the
reaction mixture generates the final product.
are
less desireable, albeit credit-earning, alternatives because
elimination of HBr or HCl would be a significant side reaction with
these secondary alkyl halides.
19. Predict the product of the following reaction:OS(=O)(=O)c1cccc2cccnc12
The electrophile will react preferentially on
the ring that does not contain the nitrogen atom. Drawing the
appropriate resonance structures indicates that the intermediate
carbocations formed by attack of the electrophile on positions 1 and
3 should be more stable than the alternatives generated by reaction
at 2 or 4. H-bonding favors sulfonation at position 1 over position
3.
20. Enter the number of the carbon atom in pyrimidine, ,
where an electrophile would be most likely to bond.
3 When an electrophile bonds to C-1, C-2, or
C-4, the resulting carbocationic intermediates all have two resonance
contributors in which the positive charge is localized on one of the
nitrogen atoms, e.g.
.
Note that in this structure there are only 6 electrons around the
positively charged nitrogen. Not good. Bonding the electrophile to
C-3 does not generate comparable structures.
21. The synthesis of involves
three of the four compounds shown below. Which one is not
involved? B
22. Arrange the following compounds in order of increasing
acidity:A<B<C
The acidity of an acid is determined by the stability of its
conjugate base. In this case that means you have to assess the
relative stabilities of
.
In particular, you are assessing the potential energy of the lone
pair of electrons on the nitrogen atoms, which correlates with the
hybridization of the nitrogen. The hybridization changes from
sp3 to sp2 to sp on going from the primary
amine to the nitrile. Electrons in an sp hybridized orbital have
lower potential energy than those in sp2 hybridized
orbitals, which have lower potential energy than those in
sp3 hybridized orbitals.
23. Draw the structure of the major product of the following
reaction sequence:
Cc1ccc(N)cn1
24. Watson and Crick were arguing over whether or not was
aromatic. Watson did not believe it was and demanded that Crick prove
otherwise, which he did by simply drawing another form of the
compound that made its aromatic character more obvious. Draw the
structure that Crick drew to convince Watson that this compound is
aromatic.
Oc1cnc(O)nc1
The original structure is a diketone. In the dienol form, the 6 pi
electron system is more obvious.
25. Draw the product of the following reaction sequence:
COc1cccc(N)c1
26. When 1 mmol of CH3CH2CH2CH2NH2 is treated with 1 mmol of CH3CH2Br, the contents of the flask at the end of the reaction are best described as
|
A. CH3CH2CH2CH2NHCH2CH3 |
B.a mixture of CH3CH2CH2CH2NHCH2CH3 and CH3CH2CH2CH2N(CH2CH3)2 |
C. a mixture of CH3CH2CH2CH2NHCH2CH3, CH3CH2CH2CH2N(CH2CH3)2, and CH3CH2CH2CH2N+(CH2CH3)3 |
D. a mixture of CH3CH2CH2CH2NH2, CH3CH2CH2CH2NHCH2CH3, CH3CH2CH2CH2N(CH2CH3)2, and CH3CH2CH2CH2N+(CH2CH3)3 |
27. Select the solvent in which the reaction would
occur the fastest.
|
A. methanol |
B. diethyl ether |
C. acetone |
D. benzene |
The reaction should be an Sn2 reaction. Since there is a build-up of charge as the transition state is formed, a polar solvent will stabilize the transition state more than it does the starting materials. This results in a decrease in the activation energy and a faster reaction.
28. How many of the following compounds could be described as b-phenylethylamines? 3 Only the second structure is not a b-phenylethylamine.
29. Figure 8 of the topic Amines II presents the structures of four alkaloids that are derived from the amino acid tryptophan. How many of them may be classified as b-phenylethylamines? 3 Only quinine does not qualify.
30. Predict the product of the following
reaction. Assume the reactants are mixed in a 1/1 ratio and that
there has been an appropriate work-up.
CCNCCO The outcome here is different than in the O-methylation
reactions involving S-adenosyllmethionine. In the enzyme catalysed
reactions the amino group is bound to the active site of the enzyme
and is not available to act as a nucleophile. In a test tube, the
inherently greater reactivity of the nitrogen atom leads to reaction
at that atom.